C19H24NO2+ — CID 140815406
[(2R)-3,3-dimethylbutan-2-yl] 2-(3-phenylpyridin-1-ium-1-yl)acetate (PubChem CID 140815406) has the molecular formula C19H24NO2+ and a molecular weight of 298.41 g/mol. Its IUPAC name is [(2R)-3,3-dimethylbutan-2-yl] 2-(3-phenylpyridin-1-ium-1-yl)acetate.
| Compound Name | [(2R)-3,3-dimethylbutan-2-yl] 2-(3-phenylpyridin-1-ium-1-yl)acetate |
|---|---|
| PubChem CID | 140815406 |
| Molecular Formula | C19H24NO2+ |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(2R)-3,3-dimethylbutan-2-yl] 2-(3-phenylpyridin-1-ium-1-yl)acetate |
| SMILES | C[C@@H](OC(=O)C[n+]1cccc(-c2ccccc2)c1)C(C)(C)C |
| InChI | InChI=1S/C19H24NO2/c1-15(19(2,3)4)22-18(21)14-20-12-8-11-17(13-20)16-9-6-5-7-10-16/h5-13,15H,14H2,1-4H3/q+1/t15-/m1/s1 |
| InChIKey | FCNDNCQBRHIYMK-OAHLLOKOSA-N |
| XLogP | 3.62 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|