C17H21N2O2+ — CID 8751158
2-(3-hydroxypyridin-1-ium-1-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide (PubChem CID 8751158) has the molecular formula C17H21N2O2+ and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-(3-hydroxypyridin-1-ium-1-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(3-hydroxypyridin-1-ium-1-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 8751158 |
| Molecular Formula | C17H21N2O2+ |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-(3-hydroxypyridin-1-ium-1-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)C[n+]1cccc(O)c1 |
| InChI | InChI=1S/C17H20N2O2/c1-14(9-10-15-6-3-2-4-7-15)18-17(21)13-19-11-5-8-16(20)12-19/h2-8,11-12,14H,9-10,13H2,1H3,(H-,18,20,21)/p+1/t14-/m0/s1 |
| InChIKey | XREMKNAOTYKUDP-AWEZNQCLSA-O |
| XLogP | 1.82 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|