C13H20N3O3+ — CID 8773586
2-(3-hydroxypyridin-1-ium-1-yl)-N-(3-methylbutylcarbamoyl)acetamide (PubChem CID 8773586) has the molecular formula C13H20N3O3+ and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-(3-hydroxypyridin-1-ium-1-yl)-N-(3-methylbutylcarbamoyl)acetamide.
| Compound Name | 2-(3-hydroxypyridin-1-ium-1-yl)-N-(3-methylbutylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8773586 |
| Molecular Formula | C13H20N3O3+ |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-(3-hydroxypyridin-1-ium-1-yl)-N-(3-methylbutylcarbamoyl)acetamide |
| SMILES | CC(C)CCNC(=O)NC(=O)C[n+]1cccc(O)c1 |
| InChI | InChI=1S/C13H19N3O3/c1-10(2)5-6-14-13(19)15-12(18)9-16-7-3-4-11(17)8-16/h3-4,7-8,10H,5-6,9H2,1-2H3,(H2-,14,15,17,18,19)/p+1 |
| InChIKey | KOZWAEBUNONKQG-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 82.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|