C16H26N3O2+ — CID 8878002
2-(4-pentan-3-ylpyridin-1-ium-1-yl)-N-(propylcarbamoyl)acetamide (PubChem CID 8878002) has the molecular formula C16H26N3O2+ and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-(4-pentan-3-ylpyridin-1-ium-1-yl)-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-(4-pentan-3-ylpyridin-1-ium-1-yl)-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8878002 |
| Molecular Formula | C16H26N3O2+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-(4-pentan-3-ylpyridin-1-ium-1-yl)-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)C[n+]1ccc(C(CC)CC)cc1 |
| InChI | InChI=1S/C16H25N3O2/c1-4-9-17-16(21)18-15(20)12-19-10-7-14(8-11-19)13(5-2)6-3/h7-8,10-11,13H,4-6,9,12H2,1-3H3,(H-,17,18,20,21)/p+1 |
| InChIKey | QHJLSJGHHGZEIM-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|