C15H25N4O2+ — CID 8864731
2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-(3-methylbutylcarbamoyl)acetamide (PubChem CID 8864731) has the molecular formula C15H25N4O2+ and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-(3-methylbutylcarbamoyl)acetamide.
| Compound Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-(3-methylbutylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8864731 |
| Molecular Formula | C15H25N4O2+ |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-(3-methylbutylcarbamoyl)acetamide |
| SMILES | CC(C)CCNC(=O)NC(=O)C[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C15H24N4O2/c1-12(2)5-8-16-15(21)17-14(20)11-19-9-6-13(7-10-19)18(3)4/h6-7,9-10,12H,5,8,11H2,1-4H3,(H-,16,17,20,21)/p+1 |
| InChIKey | KPOVMPLFEMQEMI-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|