C14H14BrN2O2+ — CID 8751353
N-(2-bromo-4-methylphenyl)-2-(3-hydroxypyridin-1-ium-1-yl)acetamide (PubChem CID 8751353) has the molecular formula C14H14BrN2O2+ and a molecular weight of 322.18 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-(3-hydroxypyridin-1-ium-1-yl)acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-(3-hydroxypyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8751353 |
| Molecular Formula | C14H14BrN2O2+ |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-(3-hydroxypyridin-1-ium-1-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)C[n+]2cccc(O)c2)c(Br)c1 |
| InChI | InChI=1S/C14H13BrN2O2/c1-10-4-5-13(12(15)7-10)16-14(19)9-17-6-2-3-11(18)8-17/h2-8H,9H2,1H3,(H-,16,18,19)/p+1 |
| InChIKey | JHCMJISKPPUDHM-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|