C16H18BrN2O+ — CID 8828520
N-(2-bromo-4-methylphenyl)-2-(2,3-dimethylpyridin-1-ium-1-yl)acetamide (PubChem CID 8828520) has the molecular formula C16H18BrN2O+ and a molecular weight of 334.24 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-(2,3-dimethylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-(2,3-dimethylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8828520 |
| Molecular Formula | C16H18BrN2O+ |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-(2,3-dimethylpyridin-1-ium-1-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)C[n+]2cccc(C)c2C)c(Br)c1 |
| InChI | InChI=1S/C16H17BrN2O/c1-11-6-7-15(14(17)9-11)18-16(20)10-19-8-4-5-12(2)13(19)3/h4-9H,10H2,1-3H3/p+1 |
| InChIKey | YPOCHMRHZNDMAZ-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|