C20H22FN3O — CID 52933799
(3aR,6aS)-2-benzyl-N-(3-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 52933799) has the molecular formula C20H22FN3O and a molecular weight of 339.41 g/mol. Its IUPAC name is (3aR,6aS)-2-benzyl-N-(3-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-2-benzyl-N-(3-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 52933799 |
| Molecular Formula | C20H22FN3O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (3aR,6aS)-2-benzyl-N-(3-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)N1C[C@H]2CN(Cc3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C20H22FN3O/c21-18-7-4-8-19(9-18)22-20(25)24-13-16-11-23(12-17(16)14-24)10-15-5-2-1-3-6-15/h1-9,16-17H,10-14H2,(H,22,25)/t16-,17+ |
| InChIKey | FZMUUBJUBQJEBK-CALCHBBNSA-N |
| XLogP | 3.42 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |