C22H23N3O4 — CID 52934161
5-(5-formyl-6-hydroxynaphthalen-2-yl)-N-[2-(2-methoxyethylamino)ethyl]pyridine-2-carboxamide (PubChem CID 52934161) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 5-(5-formyl-6-hydroxynaphthalen-2-yl)-N-[2-(2-methoxyethylamino)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-(5-formyl-6-hydroxynaphthalen-2-yl)-N-[2-(2-methoxyethylamino)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 52934161 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5-(5-formyl-6-hydroxynaphthalen-2-yl)-N-[2-(2-methoxyethylamino)ethyl]pyridine-2-carboxamide |
| SMILES | COCCNCCNC(=O)c1ccc(-c2ccc3c(C=O)c(O)ccc3c2)cn1 |
| InChI | InChI=1S/C22H23N3O4/c1-29-11-10-23-8-9-24-22(28)20-6-3-17(13-25-20)15-2-5-18-16(12-15)4-7-21(27)19(18)14-26/h2-7,12-14,23,27H,8-11H2,1H3,(H,24,28) |
| InChIKey | GQAOATXGMSNLLF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|