C16H14N6O2S — CID 52934521
N-methyl-3-(4,6,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-3-ylamino)benzenesulfonamide (PubChem CID 52934521) has the molecular formula C16H14N6O2S and a molecular weight of 354.40 g/mol. Its IUPAC name is N-methyl-3-(4,6,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-3-ylamino)benzenesulfonamide.
| Compound Name | N-methyl-3-(4,6,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-3-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 52934521 |
| Molecular Formula | C16H14N6O2S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-methyl-3-(4,6,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-3-ylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(Nc2ncnc3[nH]c4ccncc4c23)c1 |
| InChI | InChI=1S/C16H14N6O2S/c1-17-25(23,24)11-4-2-3-10(7-11)21-15-14-12-8-18-6-5-13(12)22-16(14)20-9-19-15/h2-9,17H,1H3,(H2,19,20,21,22) |
| InChIKey | MFBVXOAQHBBEAS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |