C31H34N4O4 — CID 52935612
2,4-bis(4-methoxyphenoxy)-N-[1-(2-phenylethyl)piperidin-4-yl]pyrimidin-5-amine (PubChem CID 52935612) has the molecular formula C31H34N4O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is 2,4-bis(4-methoxyphenoxy)-N-[1-(2-phenylethyl)piperidin-4-yl]pyrimidin-5-amine.
| Compound Name | 2,4-bis(4-methoxyphenoxy)-N-[1-(2-phenylethyl)piperidin-4-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 52935612 |
| Molecular Formula | C31H34N4O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 2,4-bis(4-methoxyphenoxy)-N-[1-(2-phenylethyl)piperidin-4-yl]pyrimidin-5-amine |
| SMILES | COc1ccc(Oc2ncc(NC3CCN(CCc4ccccc4)CC3)c(Oc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C31H34N4O4/c1-36-25-8-12-27(13-9-25)38-30-29(22-32-31(34-30)39-28-14-10-26(37-2)11-15-28)33-24-17-20-35(21-18-24)19-16-23-6-4-3-5-7-23/h3-15,22,24,33H,16-21H2,1-2H3 |
| InChIKey | CCDPGRKQMYVLGO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |