C31H24N6OS — CID 52935909
1-(4-benzoylphenyl)-3-(1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl)thiourea (PubChem CID 52935909) has the molecular formula C31H24N6OS and a molecular weight of 528.64 g/mol. Its IUPAC name is 1-(4-benzoylphenyl)-3-(1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl)thiourea.
| Compound Name | 1-(4-benzoylphenyl)-3-(1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl)thiourea |
|---|---|
| PubChem CID | 52935909 |
| Molecular Formula | C31H24N6OS |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 1-(4-benzoylphenyl)-3-(1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl)thiourea |
| SMILES | Cc1nnc2n1-c1ccccc1C(c1ccccc1)=NC2NC(=S)Nc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H24N6OS/c1-20-35-36-30-29(33-27(21-10-4-2-5-11-21)25-14-8-9-15-26(25)37(20)30)34-31(39)32-24-18-16-23(17-19-24)28(38)22-12-6-3-7-13-22/h2-19,29H,1H3,(H2,32,34,39) |
| InChIKey | DXONYAQIDVGIPD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|