C17H12N2O3S — CID 5293905
(4Z)-2-(4-methylphenyl)-4-[(3-nitrophenyl)methylidene]-1,3-thiazol-5-one (PubChem CID 5293905) has the molecular formula C17H12N2O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is (4Z)-2-(4-methylphenyl)-4-[(3-nitrophenyl)methylidene]-1,3-thiazol-5-one.
| Compound Name | (4Z)-2-(4-methylphenyl)-4-[(3-nitrophenyl)methylidene]-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 5293905 |
| Molecular Formula | C17H12N2O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (4Z)-2-(4-methylphenyl)-4-[(3-nitrophenyl)methylidene]-1,3-thiazol-5-one |
| SMILES | Cc1ccc(C2=N/C(=C\c3cccc([N+](=O)[O-])c3)C(=O)S2)cc1 |
| InChI | InChI=1S/C17H12N2O3S/c1-11-5-7-13(8-6-11)16-18-15(17(20)23-16)10-12-3-2-4-14(9-12)19(21)22/h2-10H,1H3/b15-10- |
| InChIKey | YQSGFAJVDVFGFI-GDNBJRDFSA-N |
| XLogP | 3.96 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|