C23H29N3O2S — CID 52941001
(4-cyclobutylpiperazin-1-yl)-[3-(piperidine-1-carbonyl)-1-benzothiophen-5-yl]methanone (PubChem CID 52941001) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is (4-cyclobutylpiperazin-1-yl)-[3-(piperidine-1-carbonyl)-1-benzothiophen-5-yl]methanone.
| Compound Name | (4-cyclobutylpiperazin-1-yl)-[3-(piperidine-1-carbonyl)-1-benzothiophen-5-yl]methanone |
|---|---|
| PubChem CID | 52941001 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (4-cyclobutylpiperazin-1-yl)-[3-(piperidine-1-carbonyl)-1-benzothiophen-5-yl]methanone |
| SMILES | O=C(c1ccc2scc(C(=O)N3CCCCC3)c2c1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C23H29N3O2S/c27-22(26-13-11-24(12-14-26)18-5-4-6-18)17-7-8-21-19(15-17)20(16-29-21)23(28)25-9-2-1-3-10-25/h7-8,15-16,18H,1-6,9-14H2 |
| InChIKey | XRYJTISFHQDRSM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |