C22H16ClFN2 — CID 52941240
5-(4-benzylphenyl)-2-(2-chloro-6-fluorophenyl)-1H-imidazole (PubChem CID 52941240) has the molecular formula C22H16ClFN2 and a molecular weight of 362.84 g/mol. Its IUPAC name is 5-(4-benzylphenyl)-2-(2-chloro-6-fluorophenyl)-1H-imidazole.
| Compound Name | 5-(4-benzylphenyl)-2-(2-chloro-6-fluorophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 52941240 |
| Molecular Formula | C22H16ClFN2 |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 5-(4-benzylphenyl)-2-(2-chloro-6-fluorophenyl)-1H-imidazole |
| SMILES | Fc1cccc(Cl)c1-c1ncc(-c2ccc(Cc3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C22H16ClFN2/c23-18-7-4-8-19(24)21(18)22-25-14-20(26-22)17-11-9-16(10-12-17)13-15-5-2-1-3-6-15/h1-12,14H,13H2,(H,25,26) |
| InChIKey | QYJAWUPQJQNQMO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |