C26H27ClN2 — CID 141189854
2-(5-chloro-2-methylnaphthalen-1-yl)-5-(4-hexylphenyl)-1H-imidazole (PubChem CID 141189854) has the molecular formula C26H27ClN2 and a molecular weight of 402.97 g/mol. Its IUPAC name is 2-(5-chloro-2-methylnaphthalen-1-yl)-5-(4-hexylphenyl)-1H-imidazole.
| Compound Name | 2-(5-chloro-2-methylnaphthalen-1-yl)-5-(4-hexylphenyl)-1H-imidazole |
|---|---|
| PubChem CID | 141189854 |
| Molecular Formula | C26H27ClN2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-(5-chloro-2-methylnaphthalen-1-yl)-5-(4-hexylphenyl)-1H-imidazole |
| SMILES | CCCCCCc1ccc(-c2cnc(-c3c(C)ccc4c(Cl)cccc34)[nH]2)cc1 |
| InChI | InChI=1S/C26H27ClN2/c1-3-4-5-6-8-19-12-14-20(15-13-19)24-17-28-26(29-24)25-18(2)11-16-21-22(25)9-7-10-23(21)27/h7,9-17H,3-6,8H2,1-2H3,(H,28,29) |
| InChIKey | BQHAUJOWLSGKJL-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|