C20H16O6 — CID 52941330
4-[(7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxymethyl]benzoic acid (PubChem CID 52941330) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is 4-[(7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxymethyl]benzoic acid.
| Compound Name | 4-[(7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 52941330 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 4-[(7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2cc(O)cc3oc(=O)c4c(c23)CCC4)cc1 |
| InChI | InChI=1S/C20H16O6/c21-13-8-16(25-10-11-4-6-12(7-5-11)19(22)23)18-14-2-1-3-15(14)20(24)26-17(18)9-13/h4-9,21H,1-3,10H2,(H,22,23) |
| InChIKey | XLBXITIJRKLVMO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|