C29H33N3O4 — CID 52942059
3-(diethylamino)-N-[10-[(3,5-dimethoxyphenyl)methyl]-9-oxoacridin-2-yl]propanamide (PubChem CID 52942059) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is 3-(diethylamino)-N-[10-[(3,5-dimethoxyphenyl)methyl]-9-oxoacridin-2-yl]propanamide.
| Compound Name | 3-(diethylamino)-N-[10-[(3,5-dimethoxyphenyl)methyl]-9-oxoacridin-2-yl]propanamide |
|---|---|
| PubChem CID | 52942059 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 3-(diethylamino)-N-[10-[(3,5-dimethoxyphenyl)methyl]-9-oxoacridin-2-yl]propanamide |
| SMILES | CCN(CC)CCC(=O)Nc1ccc2c(c1)c(=O)c1ccccc1n2Cc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C29H33N3O4/c1-5-31(6-2)14-13-28(33)30-21-11-12-27-25(17-21)29(34)24-9-7-8-10-26(24)32(27)19-20-15-22(35-3)18-23(16-20)36-4/h7-12,15-18H,5-6,13-14,19H2,1-4H3,(H,30,33) |
| InChIKey | VJNJRJYZIPHNOK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|