C22H23Cl2NO7 — CID 52942768
(4-methoxyphenyl)methyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;oxalic acid (PubChem CID 52942768) has the molecular formula C22H23Cl2NO7 and a molecular weight of 484.33 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;oxalic acid.
| Compound Name | (4-methoxyphenyl)methyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 52942768 |
| Molecular Formula | C22H23Cl2NO7 |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | (4-methoxyphenyl)methyl 4-(3,4-dichlorophenyl)piperidine-4-carboxylate;oxalic acid |
| SMILES | COc1ccc(COC(=O)C2(c3ccc(Cl)c(Cl)c3)CCNCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H21Cl2NO3.C2H2O4/c1-25-16-5-2-14(3-6-16)13-26-19(24)20(8-10-23-11-9-20)15-4-7-17(21)18(22)12-15;3-1(4)2(5)6/h2-7,12,23H,8-11,13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | WTDGSAUHNPOZAQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|