C24H20Cl2O3S — CID 52943256
(E)-1-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfonyl]-3-(3,5-dimethylphenyl)prop-2-en-1-one (PubChem CID 52943256) has the molecular formula C24H20Cl2O3S and a molecular weight of 459.39 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfonyl]-3-(3,5-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfonyl]-3-(3,5-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 52943256 |
| Molecular Formula | C24H20Cl2O3S |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfonyl]-3-(3,5-dimethylphenyl)prop-2-en-1-one |
| SMILES | Cc1cc(C)cc(/C=C(\C(=O)c2ccc(Cl)cc2)S(=O)(=O)Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H20Cl2O3S/c1-16-11-17(2)13-19(12-16)14-23(24(27)20-5-9-22(26)10-6-20)30(28,29)15-18-3-7-21(25)8-4-18/h3-14H,15H2,1-2H3/b23-14+ |
| InChIKey | WZSRWJBUQNPGMO-OEAKJJBVSA-N |
| XLogP | 6.45 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|