C23H17Cl3O3S — CID 52945687
(E)-1-(4-chlorophenyl)-3-(2,3-dichlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]prop-2-en-1-one (PubChem CID 52945687) has the molecular formula C23H17Cl3O3S and a molecular weight of 479.81 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-3-(2,3-dichlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-chlorophenyl)-3-(2,3-dichlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 52945687 |
| Molecular Formula | C23H17Cl3O3S |
| Molecular Weight | 479.81 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-3-(2,3-dichlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]prop-2-en-1-one |
| SMILES | Cc1ccc(CS(=O)(=O)/C(=C/c2cccc(Cl)c2Cl)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H17Cl3O3S/c1-15-5-7-16(8-6-15)14-30(28,29)21(13-18-3-2-4-20(25)22(18)26)23(27)17-9-11-19(24)12-10-17/h2-13H,14H2,1H3/b21-13+ |
| InChIKey | UVIRMWANRNBIIU-FYJGNVAPSA-N |
| XLogP | 6.79 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.81 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|