C25H38O8 — CID 52943619
5-[(3S)-4-[2-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-5-oxooxolan-3-yl]oxy-5-oxopentanoic acid (PubChem CID 52943619) has the molecular formula C25H38O8 and a molecular weight of 466.57 g/mol. Its IUPAC name is 5-[(3S)-4-[2-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-5-oxooxolan-3-yl]oxy-5-oxopentanoic acid.
| Compound Name | 5-[(3S)-4-[2-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-5-oxooxolan-3-yl]oxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 52943619 |
| Molecular Formula | C25H38O8 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 5-[(3S)-4-[2-[(1R,4aS,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-5-oxooxolan-3-yl]oxy-5-oxopentanoic acid |
| SMILES | C=C1CC[C@@H]2[C@](C)(CO)[C@H](O)CC[C@@]2(C)[C@@H]1CCC1C(=O)OC[C@H]1OC(=O)CCCC(=O)O |
| InChI | InChI=1S/C25H38O8/c1-15-7-10-19-24(2,12-11-20(27)25(19,3)14-26)17(15)9-8-16-18(13-32-23(16)31)33-22(30)6-4-5-21(28)29/h16-20,26-27H,1,4-14H2,2-3H3,(H,28,29)/t16?,17-,18-,19+,20-,24+,25+/m1/s1 |
| InChIKey | HZSGEWUDGXUAQJ-KRTJDGHRSA-N |
| XLogP | 2.85 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|