C33H41NO5 — CID 52943720
3-[3-[2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxan-2-yl]propyl]-8-phenylmethoxy-1,2,4,5-tetrahydro-3-benzazepin-5-ol (PubChem CID 52943720) has the molecular formula C33H41NO5 and a molecular weight of 531.69 g/mol. Its IUPAC name is 3-[3-[2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxan-2-yl]propyl]-8-phenylmethoxy-1,2,4,5-tetrahydro-3-benzazepin-5-ol.
| Compound Name | 3-[3-[2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxan-2-yl]propyl]-8-phenylmethoxy-1,2,4,5-tetrahydro-3-benzazepin-5-ol |
|---|---|
| PubChem CID | 52943720 |
| Molecular Formula | C33H41NO5 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | 3-[3-[2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxan-2-yl]propyl]-8-phenylmethoxy-1,2,4,5-tetrahydro-3-benzazepin-5-ol |
| SMILES | COc1ccc(C2(CCCN3CCc4cc(OCc5ccccc5)ccc4C(O)C3)OCC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C33H41NO5/c1-32(2)23-38-33(39-24-32,27-10-12-28(36-3)13-11-27)17-7-18-34-19-16-26-20-29(14-15-30(26)31(35)21-34)37-22-25-8-5-4-6-9-25/h4-6,8-15,20,31,35H,7,16-19,21-24H2,1-3H3 |
| InChIKey | YACCVVUNICRPSW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |