C26H23Cl2F3N2O3 — CID 52944154
N-[7-(4-chloro-2-methylphenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide (PubChem CID 52944154) has the molecular formula C26H23Cl2F3N2O3 and a molecular weight of 539.38 g/mol. Its IUPAC name is N-[7-(4-chloro-2-methylphenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide.
| Compound Name | N-[7-(4-chloro-2-methylphenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide |
|---|---|
| PubChem CID | 52944154 |
| Molecular Formula | C26H23Cl2F3N2O3 |
| Molecular Weight | 539.38 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | N-[7-(4-chloro-2-methylphenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide |
| SMILES | Cc1cc(Cl)ccc1-c1nc2c(cc1-c1ccc(Cl)cc1)C(NC(=O)C(O)C(F)(F)F)CC(C)(C)O2 |
| InChI | InChI=1S/C26H23Cl2F3N2O3/c1-13-10-16(28)8-9-17(13)21-18(14-4-6-15(27)7-5-14)11-19-20(12-25(2,3)36-24(19)33-21)32-23(35)22(34)26(29,30)31/h4-11,20,22,34H,12H2,1-3H3,(H,32,35) |
| InChIKey | CHLLVQZFMABVHW-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.38 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |