C22H24ClN6O3S- — CID 52944380
4-[4-[(2R)-2-amino-3-(4-chlorophenyl)propanoyl]piperazin-1-yl]-6-[methyl(sulfinato)amino]quinazoline (PubChem CID 52944380) has the molecular formula C22H24ClN6O3S- and a molecular weight of 487.99 g/mol. Its IUPAC name is 4-[4-[(2R)-2-amino-3-(4-chlorophenyl)propanoyl]piperazin-1-yl]-6-[methyl(sulfinato)amino]quinazoline.
| Compound Name | 4-[4-[(2R)-2-amino-3-(4-chlorophenyl)propanoyl]piperazin-1-yl]-6-[methyl(sulfinato)amino]quinazoline |
|---|---|
| PubChem CID | 52944380 |
| Molecular Formula | C22H24ClN6O3S- |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 4-[4-[(2R)-2-amino-3-(4-chlorophenyl)propanoyl]piperazin-1-yl]-6-[methyl(sulfinato)amino]quinazoline |
| SMILES | CN(c1ccc2ncnc(N3CCN(C(=O)[C@H](N)Cc4ccc(Cl)cc4)CC3)c2c1)S(=O)[O-] |
| InChI | InChI=1S/C22H25ClN6O3S/c1-27(33(31)32)17-6-7-20-18(13-17)21(26-14-25-20)28-8-10-29(11-9-28)22(30)19(24)12-15-2-4-16(23)5-3-15/h2-7,13-14,19H,8-12,24H2,1H3,(H,31,32)/p-1/t19-/m1/s1 |
| InChIKey | PMSXYAVMBHYTJN-LJQANCHMSA-M |
| XLogP | 1.73 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|