C19H15ClO — CID 52945644
6-chloro-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]-2H-chromene (PubChem CID 52945644) has the molecular formula C19H15ClO and a molecular weight of 294.78 g/mol. Its IUPAC name is 6-chloro-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]-2H-chromene.
| Compound Name | 6-chloro-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]-2H-chromene |
|---|---|
| PubChem CID | 52945644 |
| Molecular Formula | C19H15ClO |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 6-chloro-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]-2H-chromene |
| SMILES | Clc1ccc2c(c1)C=C(/C=C/C=C/c1ccccc1)CO2 |
| InChI | InChI=1S/C19H15ClO/c20-18-10-11-19-17(13-18)12-16(14-21-19)9-5-4-8-15-6-2-1-3-7-15/h1-13H,14H2/b8-4+,9-5+ |
| InChIKey | JVMROZKAAVQOAF-KBXRYBNXSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|