C21H12Br2F2O3S — CID 52947875
(E)-1-(4-bromophenyl)-2-(4-bromophenyl)sulfonyl-3-(2,4-difluorophenyl)prop-2-en-1-one (PubChem CID 52947875) has the molecular formula C21H12Br2F2O3S and a molecular weight of 542.20 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-2-(4-bromophenyl)sulfonyl-3-(2,4-difluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-2-(4-bromophenyl)sulfonyl-3-(2,4-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 52947875 |
| Molecular Formula | C21H12Br2F2O3S |
| Molecular Weight | 542.20 g/mol |
| Exact Mass | 539.88 |
| IUPAC Name | (E)-1-(4-bromophenyl)-2-(4-bromophenyl)sulfonyl-3-(2,4-difluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C(=C\c1ccc(F)cc1F)S(=O)(=O)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H12Br2F2O3S/c22-15-4-1-13(2-5-15)21(26)20(11-14-3-8-17(24)12-19(14)25)29(27,28)18-9-6-16(23)7-10-18/h1-12H/b20-11+ |
| InChIKey | PQVJEXYLEQBPMH-RGVLZGJSSA-N |
| XLogP | 6.19 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.20 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|