C21H16BrFO3S2 — CID 52948115
(E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 52948115) has the molecular formula C21H16BrFO3S2 and a molecular weight of 479.39 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 52948115 |
| Molecular Formula | C21H16BrFO3S2 |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | (E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C(\C(=O)c2ccc(Br)cc2)S(=O)(=O)Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C21H16BrFO3S2/c1-14-2-11-19(27-14)12-20(21(24)16-5-7-17(22)8-6-16)28(25,26)13-15-3-9-18(23)10-4-15/h2-12H,13H2,1H3/b20-12+ |
| InChIKey | NKORTJQXBAYHMX-UDWIEESQSA-N |
| XLogP | 5.80 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|