C18H24N8O3 — CID 52948257
(2S)-2-[[2-[4-[(4-carbamimidoylpiperazin-1-yl)methyl]triazol-1-yl]acetyl]amino]-2-phenylacetic acid (PubChem CID 52948257) has the molecular formula C18H24N8O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is (2S)-2-[[2-[4-[(4-carbamimidoylpiperazin-1-yl)methyl]triazol-1-yl]acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[2-[4-[(4-carbamimidoylpiperazin-1-yl)methyl]triazol-1-yl]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 52948257 |
| Molecular Formula | C18H24N8O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (2S)-2-[[2-[4-[(4-carbamimidoylpiperazin-1-yl)methyl]triazol-1-yl]acetyl]amino]-2-phenylacetic acid |
| SMILES | [H]/N=C(\N)N1CCN(Cc2cn(CC(=O)N[C@H](C(=O)O)c3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C18H24N8O3/c19-18(20)25-8-6-24(7-9-25)10-14-11-26(23-22-14)12-15(27)21-16(17(28)29)13-4-2-1-3-5-13/h1-5,11,16H,6-10,12H2,(H3,19,20)(H,21,27)(H,28,29)/t16-/m0/s1 |
| InChIKey | MVZWLFHVMJCBJC-INIZCTEOSA-N |
| XLogP | -0.77 |
| TPSA | 153.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|