C32H33NO4 — CID 52949336
4-[4-[[4-[4-(dimethylamino)-1-hydroxy-1-phenylbutyl]phenoxy]methyl]phenyl]benzoic acid (PubChem CID 52949336) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 4-[4-[[4-[4-(dimethylamino)-1-hydroxy-1-phenylbutyl]phenoxy]methyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[[4-[4-(dimethylamino)-1-hydroxy-1-phenylbutyl]phenoxy]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 52949336 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 4-[4-[[4-[4-(dimethylamino)-1-hydroxy-1-phenylbutyl]phenoxy]methyl]phenyl]benzoic acid |
| SMILES | CN(C)CCCC(O)(c1ccccc1)c1ccc(OCc2ccc(-c3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H33NO4/c1-33(2)22-6-21-32(36,28-7-4-3-5-8-28)29-17-19-30(20-18-29)37-23-24-9-11-25(12-10-24)26-13-15-27(16-14-26)31(34)35/h3-5,7-20,36H,6,21-23H2,1-2H3,(H,34,35) |
| InChIKey | DFHCZTWDKWGWLI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |