C22H38O4Si — CID 52951902
(2S)-2-[[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]oxolan-2-yl]methyl]-4-methyl-2,3-dihydropyran-6-one (PubChem CID 52951902) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is (2S)-2-[[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]oxolan-2-yl]methyl]-4-methyl-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]oxolan-2-yl]methyl]-4-methyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 52951902 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (2S)-2-[[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]oxolan-2-yl]methyl]-4-methyl-2,3-dihydropyran-6-one |
| SMILES | CC(C)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H](C[C@@H]2CC(C)=CC(=O)O2)O1 |
| InChI | InChI=1S/C22H38O4Si/c1-15(2)11-20(26-27(7,8)22(4,5)6)19-10-9-17(24-19)14-18-12-16(3)13-21(23)25-18/h11,13,17-20H,9-10,12,14H2,1-8H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | KDLCJSJORDFKCO-IYWMVGAKSA-N |
| XLogP | 5.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|