C15H18N6O — CID 52953037
1-(3,5-diamino-4,5-dihydro-1H-pyrazol-4-yl)-3-(1H-indol-3-yl)-2-(methylideneamino)propan-1-one (PubChem CID 52953037) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-(3,5-diamino-4,5-dihydro-1H-pyrazol-4-yl)-3-(1H-indol-3-yl)-2-(methylideneamino)propan-1-one.
| Compound Name | 1-(3,5-diamino-4,5-dihydro-1H-pyrazol-4-yl)-3-(1H-indol-3-yl)-2-(methylideneamino)propan-1-one |
|---|---|
| PubChem CID | 52953037 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(3,5-diamino-4,5-dihydro-1H-pyrazol-4-yl)-3-(1H-indol-3-yl)-2-(methylideneamino)propan-1-one |
| SMILES | C=NC(Cc1c[nH]c2ccccc12)C(=O)C1C(N)=NNC1N |
| InChI | InChI=1S/C15H18N6O/c1-18-11(13(22)12-14(16)20-21-15(12)17)6-8-7-19-10-5-3-2-4-9(8)10/h2-5,7,11-12,14,19-20H,1,6,16H2,(H2,17,21) |
| InChIKey | YNHYAXZXINOFOY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|