C18H17F2N3O3S — CID 52953349
1,1,2,2,3,3,3-heptadeuterio-N-[2,4-difluoro-3-[5-(trideuteriomethyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]propane-1-sulfonamide (PubChem CID 52953349) has the molecular formula C18H17F2N3O3S and a molecular weight of 403.48 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptadeuterio-N-[2,4-difluoro-3-[5-(trideuteriomethyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]propane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,3-heptadeuterio-N-[2,4-difluoro-3-[5-(trideuteriomethyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 52953349 |
| Molecular Formula | C18H17F2N3O3S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1,1,2,2,3,3,3-heptadeuterio-N-[2,4-difluoro-3-[5-(trideuteriomethyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]propane-1-sulfonamide |
| SMILES | [2H]C([2H])([2H])c1cnc2[nH]cc(C(=O)c3c(F)ccc(NS(=O)(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])c3F)c2c1 |
| InChI | InChI=1S/C18H17F2N3O3S/c1-3-6-27(25,26)23-14-5-4-13(19)15(16(14)20)17(24)12-9-22-18-11(12)7-10(2)8-21-18/h4-5,7-9,23H,3,6H2,1-2H3,(H,21,22)/i1D3,2D3,3D2,6D2 |
| InChIKey | PZCGSMIIJQLJOB-BCQSLBLCSA-N |
| XLogP | 3.53 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |