C17H14ClF2N3O3S — CID 76974090
N-[3-(5-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2,4-difluorophenyl]-2,2,3,3,3-pentadeuteriopropane-1-sulfonamide (PubChem CID 76974090) has the molecular formula C17H14ClF2N3O3S and a molecular weight of 419.86 g/mol. Its IUPAC name is N-[3-(5-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2,4-difluorophenyl]-2,2,3,3,3-pentadeuteriopropane-1-sulfonamide.
| Compound Name | N-[3-(5-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2,4-difluorophenyl]-2,2,3,3,3-pentadeuteriopropane-1-sulfonamide |
|---|---|
| PubChem CID | 76974090 |
| Molecular Formula | C17H14ClF2N3O3S |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[3-(5-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2,4-difluorophenyl]-2,2,3,3,3-pentadeuteriopropane-1-sulfonamide |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CS(=O)(=O)Nc1ccc(F)c([13C](=O)c2c[nH]c3ncc(Cl)cc23)c1F |
| InChI | InChI=1S/C17H14ClF2N3O3S/c1-2-5-27(25,26)23-13-4-3-12(19)14(15(13)20)16(24)11-8-22-17-10(11)6-9(18)7-21-17/h3-4,6-8,23H,2,5H2,1H3,(H,21,22)/i1D3,2D2,16+1 |
| InChIKey | YZDJQTHVDDOVHR-WDYDLWGMSA-N |
| XLogP | 3.88 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |