C17H15N5 — CID 5295767
N-(2-phenylethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine (PubChem CID 5295767) has the molecular formula C17H15N5 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(2-phenylethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine.
| Compound Name | N-(2-phenylethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 5295767 |
| Molecular Formula | C17H15N5 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(2-phenylethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
| SMILES | c1ccc(CCNc2nc3ccccc3n3cnnc23)cc1 |
| InChI | InChI=1S/C17H15N5/c1-2-6-13(7-3-1)10-11-18-16-17-21-19-12-22(17)15-9-5-4-8-14(15)20-16/h1-9,12H,10-11H2,(H,18,20) |
| InChIKey | RFDYKUAMPVKIDL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |