C14H17N5 — CID 6622885
N-(3-methylbutyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine (PubChem CID 6622885) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-(3-methylbutyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine.
| Compound Name | N-(3-methylbutyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 6622885 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-(3-methylbutyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
| SMILES | CC(C)CCNc1nc2ccccc2n2cnnc12 |
| InChI | InChI=1S/C14H17N5/c1-10(2)7-8-15-13-14-18-16-9-19(14)12-6-4-3-5-11(12)17-13/h3-6,9-10H,7-8H2,1-2H3,(H,15,17) |
| InChIKey | CZESBWHGNZKLNV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |