C15H10FN3O2S — CID 5297287
10-(2-fluorophenyl)-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione (PubChem CID 5297287) has the molecular formula C15H10FN3O2S and a molecular weight of 315.33 g/mol. Its IUPAC name is 10-(2-fluorophenyl)-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione.
| Compound Name | 10-(2-fluorophenyl)-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione |
|---|---|
| PubChem CID | 5297287 |
| Molecular Formula | C15H10FN3O2S |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 10-(2-fluorophenyl)-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6-triene-8,12-dione |
| SMILES | O=C1CC(c2ccccc2F)c2c(n3ccsc3nc2=O)N1 |
| InChI | InChI=1S/C15H10FN3O2S/c16-10-4-2-1-3-8(10)9-7-11(20)17-13-12(9)14(21)18-15-19(13)5-6-22-15/h1-6,9H,7H2,(H,17,20) |
| InChIKey | PLTPEUUCTHGTDV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |