C21H26N4O3S — CID 52973668
(4-benzylsulfonylpiperazin-1-yl)-(3-phenylpyrazolidin-4-yl)methanone (PubChem CID 52973668) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is (4-benzylsulfonylpiperazin-1-yl)-(3-phenylpyrazolidin-4-yl)methanone.
| Compound Name | (4-benzylsulfonylpiperazin-1-yl)-(3-phenylpyrazolidin-4-yl)methanone |
|---|---|
| PubChem CID | 52973668 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (4-benzylsulfonylpiperazin-1-yl)-(3-phenylpyrazolidin-4-yl)methanone |
| SMILES | O=C(C1CNNC1c1ccccc1)N1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N4O3S/c26-21(19-15-22-23-20(19)18-9-5-2-6-10-18)24-11-13-25(14-12-24)29(27,28)16-17-7-3-1-4-8-17/h1-10,19-20,22-23H,11-16H2 |
| InChIKey | AKGHFUACIJWEOQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |