C19H28N2O4S — CID 97160690
(4-benzylsulfonylpiperazin-1-yl)-[(2R,6R)-2,6-dimethyloxan-4-yl]methanone (PubChem CID 97160690) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is (4-benzylsulfonylpiperazin-1-yl)-[(2R,6R)-2,6-dimethyloxan-4-yl]methanone.
| Compound Name | (4-benzylsulfonylpiperazin-1-yl)-[(2R,6R)-2,6-dimethyloxan-4-yl]methanone |
|---|---|
| PubChem CID | 97160690 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (4-benzylsulfonylpiperazin-1-yl)-[(2R,6R)-2,6-dimethyloxan-4-yl]methanone |
| SMILES | C[C@@H]1CC(C(=O)N2CCN(S(=O)(=O)Cc3ccccc3)CC2)C[C@@H](C)O1 |
| InChI | InChI=1S/C19H28N2O4S/c1-15-12-18(13-16(2)25-15)19(22)20-8-10-21(11-9-20)26(23,24)14-17-6-4-3-5-7-17/h3-7,15-16,18H,8-14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | LFISYVUBAHKXPX-HZPDHXFCSA-N |
| XLogP | 1.86 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |