C18H22BrClN2O5S — CID 52988526
5-(4-bromophenyl)sulfonyl-N-(2-morpholin-4-ylpropyl)furan-2-carboxamide;hydrochloride (PubChem CID 52988526) has the molecular formula C18H22BrClN2O5S and a molecular weight of 493.81 g/mol. Its IUPAC name is 5-(4-bromophenyl)sulfonyl-N-(2-morpholin-4-ylpropyl)furan-2-carboxamide;hydrochloride.
| Compound Name | 5-(4-bromophenyl)sulfonyl-N-(2-morpholin-4-ylpropyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 52988526 |
| Molecular Formula | C18H22BrClN2O5S |
| Molecular Weight | 493.81 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | 5-(4-bromophenyl)sulfonyl-N-(2-morpholin-4-ylpropyl)furan-2-carboxamide;hydrochloride |
| SMILES | CC(CNC(=O)c1ccc(S(=O)(=O)c2ccc(Br)cc2)o1)N1CCOCC1.Cl |
| InChI | InChI=1S/C18H21BrN2O5S.ClH/c1-13(21-8-10-25-11-9-21)12-20-18(22)16-6-7-17(26-16)27(23,24)15-4-2-14(19)3-5-15;/h2-7,13H,8-12H2,1H3,(H,20,22);1H |
| InChIKey | ZSPRUTFABJDHHP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |