C16H22N4S — CID 52991413
2-[(4-pyrazolidin-3-ylpiperidin-1-yl)methyl]-1,3-benzothiazole (PubChem CID 52991413) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 2-[(4-pyrazolidin-3-ylpiperidin-1-yl)methyl]-1,3-benzothiazole.
| Compound Name | 2-[(4-pyrazolidin-3-ylpiperidin-1-yl)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 52991413 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[(4-pyrazolidin-3-ylpiperidin-1-yl)methyl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(CN3CCC(C4CCNN4)CC3)nc2c1 |
| InChI | InChI=1S/C16H22N4S/c1-2-4-15-14(3-1)18-16(21-15)11-20-9-6-12(7-10-20)13-5-8-17-19-13/h1-4,12-13,17,19H,5-11H2 |
| InChIKey | OFGYOFRKDSNFQV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |