C10H8F4O4 — CID 52991918
ethyl 2,6-bis(difluoromethyl)-4-oxopyran-3-carboxylate (PubChem CID 52991918) has the molecular formula C10H8F4O4 and a molecular weight of 268.16 g/mol. Its IUPAC name is ethyl 2,6-bis(difluoromethyl)-4-oxopyran-3-carboxylate.
| Compound Name | ethyl 2,6-bis(difluoromethyl)-4-oxopyran-3-carboxylate |
|---|---|
| PubChem CID | 52991918 |
| Molecular Formula | C10H8F4O4 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | ethyl 2,6-bis(difluoromethyl)-4-oxopyran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)F)oc(C(F)F)cc1=O |
| InChI | InChI=1S/C10H8F4O4/c1-2-17-10(16)6-4(15)3-5(8(11)12)18-7(6)9(13)14/h3,8-9H,2H2,1H3 |
| InChIKey | SGIBZSOVJVHQNA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |