C11H14N2O3S2 — CID 52992053
3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-imine (PubChem CID 52992053) has the molecular formula C11H14N2O3S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-imine.
| Compound Name | 3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 52992053 |
| Molecular Formula | C11H14N2O3S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 3-(2-methoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=c1\sc2cc(S(C)(=O)=O)ccc2n1CCOC |
| InChI | InChI=1S/C11H14N2O3S2/c1-16-6-5-13-9-4-3-8(18(2,14)15)7-10(9)17-11(13)12/h3-4,7,12H,5-6H2,1-2H3/b12-11- |
| InChIKey | MYQLJLOYEGCQKF-QXMHVHEDSA-N |
| XLogP | 1.23 |
| TPSA | 72.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |