C11H13N3O4S2 — CID 56724910
ethyl 2-(2-imino-6-sulfamoyl-1,3-benzothiazol-3-yl)acetate (PubChem CID 56724910) has the molecular formula C11H13N3O4S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is ethyl 2-(2-imino-6-sulfamoyl-1,3-benzothiazol-3-yl)acetate.
| Compound Name | ethyl 2-(2-imino-6-sulfamoyl-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 56724910 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | ethyl 2-(2-imino-6-sulfamoyl-1,3-benzothiazol-3-yl)acetate |
| SMILES | [H]/N=c1\sc2cc(S(N)(=O)=O)ccc2n1CC(=O)OCC |
| InChI | InChI=1S/C11H13N3O4S2/c1-2-18-10(15)6-14-8-4-3-7(20(13,16)17)5-9(8)19-11(14)12/h3-5,12H,2,6H2,1H3,(H2,13,16,17)/b12-11- |
| InChIKey | ZNHNPJXIHAHVOU-QXMHVHEDSA-N |
| XLogP | 0.39 |
| TPSA | 115.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |