C13H16N2O2S — CID 56724918
ethyl 2-(2-imino-5,7-dimethyl-1,3-benzothiazol-3-yl)acetate (PubChem CID 56724918) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is ethyl 2-(2-imino-5,7-dimethyl-1,3-benzothiazol-3-yl)acetate.
| Compound Name | ethyl 2-(2-imino-5,7-dimethyl-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 56724918 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | ethyl 2-(2-imino-5,7-dimethyl-1,3-benzothiazol-3-yl)acetate |
| SMILES | [H]/N=c1\sc2c(C)cc(C)cc2n1CC(=O)OCC |
| InChI | InChI=1S/C13H16N2O2S/c1-4-17-11(16)7-15-10-6-8(2)5-9(3)12(10)18-13(15)14/h5-6,14H,4,7H2,1-3H3/b14-13- |
| InChIKey | RIGAKHRKJGBBAI-YPKPFQOOSA-N |
| XLogP | 2.36 |
| TPSA | 55.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |