C13H19ClN2OS — CID 123132871
3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-imine;hydrochloride (PubChem CID 123132871) has the molecular formula C13H19ClN2OS and a molecular weight of 286.83 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-imine;hydrochloride.
| Compound Name | 3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-imine;hydrochloride |
|---|---|
| PubChem CID | 123132871 |
| Molecular Formula | C13H19ClN2OS |
| Molecular Weight | 286.83 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-imine;hydrochloride |
| SMILES | Cl.[H]/N=c1\sc2c(C)cc(C)cc2n1CCOCC |
| InChI | InChI=1S/C13H18N2OS.ClH/c1-4-16-6-5-15-11-8-9(2)7-10(3)12(11)17-13(15)14;/h7-8,14H,4-6H2,1-3H3;1H/b14-13-; |
| InChIKey | NIWHIJNWIHJXAC-HPWRNOGASA-N |
| XLogP | 3.26 |
| TPSA | 38.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.83 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|