C15H22N2O5 — CID 52997170
3-[(cyclohexylamino)methyl]-4-methoxybenzaldehyde;nitric acid (PubChem CID 52997170) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3-[(cyclohexylamino)methyl]-4-methoxybenzaldehyde;nitric acid.
| Compound Name | 3-[(cyclohexylamino)methyl]-4-methoxybenzaldehyde;nitric acid |
|---|---|
| PubChem CID | 52997170 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-[(cyclohexylamino)methyl]-4-methoxybenzaldehyde;nitric acid |
| SMILES | COc1ccc(C=O)cc1CNC1CCCCC1.O=[N+]([O-])O |
| InChI | InChI=1S/C15H21NO2.HNO3/c1-18-15-8-7-12(11-17)9-13(15)10-16-14-5-3-2-4-6-14;2-1(3)4/h7-9,11,14,16H,2-6,10H2,1H3;(H,2,3,4) |
| InChIKey | NMJWNEMRUAKTNJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|