C20H20IN3O — CID 52997856
1-methyl-3-(2-naphthalen-2-yloxyethyl)benzimidazol-2-imine;hydroiodide (PubChem CID 52997856) has the molecular formula C20H20IN3O and a molecular weight of 445.30 g/mol. Its IUPAC name is 1-methyl-3-(2-naphthalen-2-yloxyethyl)benzimidazol-2-imine;hydroiodide.
| Compound Name | 1-methyl-3-(2-naphthalen-2-yloxyethyl)benzimidazol-2-imine;hydroiodide |
|---|---|
| PubChem CID | 52997856 |
| Molecular Formula | C20H20IN3O |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 1-methyl-3-(2-naphthalen-2-yloxyethyl)benzimidazol-2-imine;hydroiodide |
| SMILES | I.[H]/N=c1\n(C)c2ccccc2n1CCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H19N3O.HI/c1-22-18-8-4-5-9-19(18)23(20(22)21)12-13-24-17-11-10-15-6-2-3-7-16(15)14-17;/h2-11,14,21H,12-13H2,1H3;1H/b21-20+; |
| InChIKey | CIOONTLLAWHXGF-ANVLNOONSA-N |
| XLogP | 4.31 |
| TPSA | 42.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|