C25H38N4O5 — CID 52997934
acetic acid;5-[(4-butoxyphenyl)methyl]-4-hydroxy-2-(3-piperidin-1-ylpropylamino)-1H-pyrimidin-6-one (PubChem CID 52997934) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is acetic acid;5-[(4-butoxyphenyl)methyl]-4-hydroxy-2-(3-piperidin-1-ylpropylamino)-1H-pyrimidin-6-one.
| Compound Name | acetic acid;5-[(4-butoxyphenyl)methyl]-4-hydroxy-2-(3-piperidin-1-ylpropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 52997934 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | acetic acid;5-[(4-butoxyphenyl)methyl]-4-hydroxy-2-(3-piperidin-1-ylpropylamino)-1H-pyrimidin-6-one |
| SMILES | CC(=O)O.CCCCOc1ccc(Cc2c(O)nc(NCCCN3CCCCC3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H34N4O3.C2H4O2/c1-2-3-16-30-19-10-8-18(9-11-19)17-20-21(28)25-23(26-22(20)29)24-12-7-15-27-13-5-4-6-14-27;1-2(3)4/h8-11H,2-7,12-17H2,1H3,(H3,24,25,26,28,29);1H3,(H,3,4) |
| InChIKey | UMUSHIFTFIKMAD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|