C18H26N4O2 — CID 54341207
2-[3-[4-(piperidin-1-ylmethyl)phenoxy]propylamino]-1H-imidazol-5-ol (PubChem CID 54341207) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[3-[4-(piperidin-1-ylmethyl)phenoxy]propylamino]-1H-imidazol-5-ol.
| Compound Name | 2-[3-[4-(piperidin-1-ylmethyl)phenoxy]propylamino]-1H-imidazol-5-ol |
|---|---|
| PubChem CID | 54341207 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 2-[3-[4-(piperidin-1-ylmethyl)phenoxy]propylamino]-1H-imidazol-5-ol |
| SMILES | Oc1cnc(NCCCOc2ccc(CN3CCCCC3)cc2)[nH]1 |
| InChI | InChI=1S/C18H26N4O2/c23-17-13-20-18(21-17)19-9-4-12-24-16-7-5-15(6-8-16)14-22-10-2-1-3-11-22/h5-8,13,23H,1-4,9-12,14H2,(H2,19,20,21) |
| InChIKey | TZBQRNNQPIFNOX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|